C13H17NO4 — CID 106187209
4-(1-hydroxy-3-methoxypropan-2-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 106187209) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is 4-(1-hydroxy-3-methoxypropan-2-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 4-(1-hydroxy-3-methoxypropan-2-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 106187209 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 4-(1-hydroxy-3-methoxypropan-2-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | COCC(CO)N1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C13H17NO4/c1-18-6-9(5-15)14-12(16)10-7-2-3-8(4-7)11(10)13(14)17/h2-3,7-11,15H,4-6H2,1H3 |
| InChIKey | NPJYICOLCFAXNL-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|