C18H20N2O6S — CID 46242611
dimethyl (2S)-2-[(4Z)-4-[(4-methoxyphenyl)methylidene]-2-methylsulfanyl-5-oxoimidazol-1-yl]butanedioate (PubChem CID 46242611) has the molecular formula C18H20N2O6S and a molecular weight of 392.43 g/mol. Its IUPAC name is dimethyl (2S)-2-[(4Z)-4-[(4-methoxyphenyl)methylidene]-2-methylsulfanyl-5-oxoimidazol-1-yl]butanedioate.
| Compound Name | dimethyl (2S)-2-[(4Z)-4-[(4-methoxyphenyl)methylidene]-2-methylsulfanyl-5-oxoimidazol-1-yl]butanedioate |
|---|---|
| PubChem CID | 46242611 |
| Molecular Formula | C18H20N2O6S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | dimethyl (2S)-2-[(4Z)-4-[(4-methoxyphenyl)methylidene]-2-methylsulfanyl-5-oxoimidazol-1-yl]butanedioate |
| SMILES | COC(=O)C[C@@H](C(=O)OC)N1C(=O)/C(=C/c2ccc(OC)cc2)N=C1SC |
| InChI | InChI=1S/C18H20N2O6S/c1-24-12-7-5-11(6-8-12)9-13-16(22)20(18(19-13)27-4)14(17(23)26-3)10-15(21)25-2/h5-9,14H,10H2,1-4H3/b13-9-/t14-/m0/s1 |
| InChIKey | KQGXSDOYAWPVTQ-XXYUJHKVSA-N |
| XLogP | 1.70 |
| TPSA | 94.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|