C20H18N2O4S — CID 21230696
methyl 2-[(4Z)-4-[(4-methoxyphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylacetate (PubChem CID 21230696) has the molecular formula C20H18N2O4S and a molecular weight of 382.44 g/mol. Its IUPAC name is methyl 2-[(4Z)-4-[(4-methoxyphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylacetate.
| Compound Name | methyl 2-[(4Z)-4-[(4-methoxyphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 21230696 |
| Molecular Formula | C20H18N2O4S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | methyl 2-[(4Z)-4-[(4-methoxyphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylacetate |
| SMILES | COC(=O)CSC1=N/C(=C\c2ccc(OC)cc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C20H18N2O4S/c1-25-16-10-8-14(9-11-16)12-17-19(24)22(15-6-4-3-5-7-15)20(21-17)27-13-18(23)26-2/h3-12H,13H2,1-2H3/b17-12- |
| InChIKey | XRLQFFOHHHFLBO-ATVHPVEESA-N |
| XLogP | 3.35 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|