C22H19N4O5S+ — CID 53290727
4-[2-[(4E)-4-[(4-methoxyphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylacetyl]-3-methyl-2H-oxadiazol-3-ium-5-one (PubChem CID 53290727) has the molecular formula C22H19N4O5S+ and a molecular weight of 451.48 g/mol. Its IUPAC name is 4-[2-[(4E)-4-[(4-methoxyphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylacetyl]-3-methyl-2H-oxadiazol-3-ium-5-one.
| Compound Name | 4-[2-[(4E)-4-[(4-methoxyphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylacetyl]-3-methyl-2H-oxadiazol-3-ium-5-one |
|---|---|
| PubChem CID | 53290727 |
| Molecular Formula | C22H19N4O5S+ |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 4-[2-[(4E)-4-[(4-methoxyphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylacetyl]-3-methyl-2H-oxadiazol-3-ium-5-one |
| SMILES | COc1ccc(/C=C2/N=C(SCC(=O)c3c(=O)o[nH][n+]3C)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C22H18N4O5S/c1-25-19(21(29)31-24-25)18(27)13-32-22-23-17(12-14-8-10-16(30-2)11-9-14)20(28)26(22)15-6-4-3-5-7-15/h3-12H,13H2,1-2H3/p+1/b17-12+ |
| InChIKey | DQYKRTWHOYVTGG-SFQUDFHCSA-O |
| XLogP | 2.16 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|