C26H19N5O5S — CID 53291024
3-(4-methoxyphenyl)-4-[2-[(4E)-5-oxo-1-phenyl-4-(pyridin-3-ylmethylidene)imidazol-2-yl]sulfanylacetyl]oxadiazol-3-ium-5-olate (PubChem CID 53291024) has the molecular formula C26H19N5O5S and a molecular weight of 513.54 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-4-[2-[(4E)-5-oxo-1-phenyl-4-(pyridin-3-ylmethylidene)imidazol-2-yl]sulfanylacetyl]oxadiazol-3-ium-5-olate.
| Compound Name | 3-(4-methoxyphenyl)-4-[2-[(4E)-5-oxo-1-phenyl-4-(pyridin-3-ylmethylidene)imidazol-2-yl]sulfanylacetyl]oxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53291024 |
| Molecular Formula | C26H19N5O5S |
| Molecular Weight | 513.54 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | 3-(4-methoxyphenyl)-4-[2-[(4E)-5-oxo-1-phenyl-4-(pyridin-3-ylmethylidene)imidazol-2-yl]sulfanylacetyl]oxadiazol-3-ium-5-olate |
| SMILES | COc1ccc(-[n+]2noc([O-])c2C(=O)CSC2=N/C(=C/c3cccnc3)C(=O)N2c2ccccc2)cc1 |
| InChI | InChI=1S/C26H19N5O5S/c1-35-20-11-9-19(10-12-20)31-23(25(34)36-29-31)22(32)16-37-26-28-21(14-17-6-5-13-27-15-17)24(33)30(26)18-7-3-2-4-8-18/h2-15H,16H2,1H3/b21-14+ |
| InChIKey | BXDXETDHPQYFFD-KGENOOAVSA-N |
| XLogP | 2.79 |
| TPSA | 124.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.54 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|