C27H19ClN4O5S — CID 53290245
4-[2-[(4E)-4-[(2-chlorophenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylacetyl]-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate (PubChem CID 53290245) has the molecular formula C27H19ClN4O5S and a molecular weight of 546.99 g/mol. Its IUPAC name is 4-[2-[(4E)-4-[(2-chlorophenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylacetyl]-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate.
| Compound Name | 4-[2-[(4E)-4-[(2-chlorophenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylacetyl]-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53290245 |
| Molecular Formula | C27H19ClN4O5S |
| Molecular Weight | 546.99 g/mol |
| Exact Mass | 546.08 |
| IUPAC Name | 4-[2-[(4E)-4-[(2-chlorophenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylacetyl]-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate |
| SMILES | COc1ccc(-[n+]2noc([O-])c2C(=O)CSC2=N/C(=C/c3ccccc3Cl)C(=O)N2c2ccccc2)cc1 |
| InChI | InChI=1S/C27H19ClN4O5S/c1-36-20-13-11-19(12-14-20)32-24(26(35)37-30-32)23(33)16-38-27-29-22(15-17-7-5-6-10-21(17)28)25(34)31(27)18-8-3-2-4-9-18/h2-15H,16H2,1H3/b22-15+ |
| InChIKey | NWEZVCYGWMOVFJ-PXLXIMEGSA-N |
| XLogP | 4.05 |
| TPSA | 111.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.99 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|