C28H23N4O5S+ — CID 53291027
3-(4-methoxyphenyl)-4-[2-[(4E)-4-[(4-methylphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylacetyl]-2H-oxadiazol-3-ium-5-one (PubChem CID 53291027) has the molecular formula C28H23N4O5S+ and a molecular weight of 527.58 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-4-[2-[(4E)-4-[(4-methylphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylacetyl]-2H-oxadiazol-3-ium-5-one.
| Compound Name | 3-(4-methoxyphenyl)-4-[2-[(4E)-4-[(4-methylphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylacetyl]-2H-oxadiazol-3-ium-5-one |
|---|---|
| PubChem CID | 53291027 |
| Molecular Formula | C28H23N4O5S+ |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | 3-(4-methoxyphenyl)-4-[2-[(4E)-4-[(4-methylphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylacetyl]-2H-oxadiazol-3-ium-5-one |
| SMILES | COc1ccc(-[n+]2[nH]oc(=O)c2C(=O)CSC2=N/C(=C/c3ccc(C)cc3)C(=O)N2c2ccccc2)cc1 |
| InChI | InChI=1S/C28H22N4O5S/c1-18-8-10-19(11-9-18)16-23-26(34)31(20-6-4-3-5-7-20)28(29-23)38-17-24(33)25-27(35)37-30-32(25)21-12-14-22(36-2)15-13-21/h3-16H,17H2,1-2H3/p+1/b23-16+ |
| InChIKey | WLDIFXPTBNLWEM-XQNSMLJCSA-O |
| XLogP | 3.92 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|