C25H26N5O4S+ — CID 53290771
4-[2-[(4E)-4-[[4-(diethylamino)phenyl]methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylacetyl]-3-methyl-2H-oxadiazol-3-ium-5-one (PubChem CID 53290771) has the molecular formula C25H26N5O4S+ and a molecular weight of 492.58 g/mol. Its IUPAC name is 4-[2-[(4E)-4-[[4-(diethylamino)phenyl]methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylacetyl]-3-methyl-2H-oxadiazol-3-ium-5-one.
| Compound Name | 4-[2-[(4E)-4-[[4-(diethylamino)phenyl]methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylacetyl]-3-methyl-2H-oxadiazol-3-ium-5-one |
|---|---|
| PubChem CID | 53290771 |
| Molecular Formula | C25H26N5O4S+ |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 4-[2-[(4E)-4-[[4-(diethylamino)phenyl]methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylacetyl]-3-methyl-2H-oxadiazol-3-ium-5-one |
| SMILES | CCN(CC)c1ccc(/C=C2/N=C(SCC(=O)c3c(=O)o[nH][n+]3C)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C25H25N5O4S/c1-4-29(5-2)18-13-11-17(12-14-18)15-20-23(32)30(19-9-7-6-8-10-19)25(26-20)35-16-21(31)22-24(33)34-27-28(22)3/h6-15H,4-5,16H2,1-3H3/p+1/b20-15+ |
| InChIKey | IIOQTJWHNBGTCH-HMMYKYKNSA-O |
| XLogP | 3.00 |
| TPSA | 102.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|