C26H29N7O3S — CID 53294478
(1E)-2-[(4E)-4-[[4-(diethylamino)phenyl]methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-[3-(dimethylamino)oxadiazol-3-ium-5-yl]ethanimidate (PubChem CID 53294478) has the molecular formula C26H29N7O3S and a molecular weight of 519.63 g/mol. Its IUPAC name is (1E)-2-[(4E)-4-[[4-(diethylamino)phenyl]methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-[3-(dimethylamino)oxadiazol-3-ium-5-yl]ethanimidate.
| Compound Name | (1E)-2-[(4E)-4-[[4-(diethylamino)phenyl]methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-[3-(dimethylamino)oxadiazol-3-ium-5-yl]ethanimidate |
|---|---|
| PubChem CID | 53294478 |
| Molecular Formula | C26H29N7O3S |
| Molecular Weight | 519.63 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | (1E)-2-[(4E)-4-[[4-(diethylamino)phenyl]methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-[3-(dimethylamino)oxadiazol-3-ium-5-yl]ethanimidate |
| SMILES | CCN(CC)c1ccc(/C=C2/N=C(SC/C([O-])=N\c3c[n+](N(C)C)no3)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C26H29N7O3S/c1-5-31(6-2)20-14-12-19(13-15-20)16-22-25(35)33(21-10-8-7-9-11-21)26(27-22)37-18-23(34)28-24-17-32(29-36-24)30(3)4/h7-17H,5-6,18H2,1-4H3/b22-16+ |
| InChIKey | IPSLDSZMHOLGMW-CJLVFECKSA-N |
| XLogP | 2.57 |
| TPSA | 104.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.63 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|