C20H16N6O3S — CID 53294079
(1E)-N-(3-methyloxadiazol-3-ium-5-yl)-2-[(4E)-5-oxo-1-phenyl-4-(pyridin-3-ylmethylidene)imidazol-2-yl]sulfanylethanimidate (PubChem CID 53294079) has the molecular formula C20H16N6O3S and a molecular weight of 420.45 g/mol. Its IUPAC name is (1E)-N-(3-methyloxadiazol-3-ium-5-yl)-2-[(4E)-5-oxo-1-phenyl-4-(pyridin-3-ylmethylidene)imidazol-2-yl]sulfanylethanimidate.
| Compound Name | (1E)-N-(3-methyloxadiazol-3-ium-5-yl)-2-[(4E)-5-oxo-1-phenyl-4-(pyridin-3-ylmethylidene)imidazol-2-yl]sulfanylethanimidate |
|---|---|
| PubChem CID | 53294079 |
| Molecular Formula | C20H16N6O3S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | (1E)-N-(3-methyloxadiazol-3-ium-5-yl)-2-[(4E)-5-oxo-1-phenyl-4-(pyridin-3-ylmethylidene)imidazol-2-yl]sulfanylethanimidate |
| SMILES | C[n+]1cc(/N=C(/[O-])CSC2=N/C(=C/c3cccnc3)C(=O)N2c2ccccc2)on1 |
| InChI | InChI=1S/C20H16N6O3S/c1-25-12-18(29-24-25)23-17(27)13-30-20-22-16(10-14-6-5-9-21-11-14)19(28)26(20)15-7-3-2-4-8-15/h2-12H,13H2,1H3/b16-10+ |
| InChIKey | AUASAWGQDRLEQT-MHWRWJLKSA-N |
| XLogP | 1.46 |
| TPSA | 110.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|