C26H22N6O3S — CID 53294498
(1E)-N-[3-(dimethylamino)oxadiazol-3-ium-5-yl]-2-[(4E)-4-(naphthalen-1-ylmethylidene)-5-oxo-1-phenylimidazol-2-yl]sulfanylethanimidate (PubChem CID 53294498) has the molecular formula C26H22N6O3S and a molecular weight of 498.57 g/mol. Its IUPAC name is (1E)-N-[3-(dimethylamino)oxadiazol-3-ium-5-yl]-2-[(4E)-4-(naphthalen-1-ylmethylidene)-5-oxo-1-phenylimidazol-2-yl]sulfanylethanimidate.
| Compound Name | (1E)-N-[3-(dimethylamino)oxadiazol-3-ium-5-yl]-2-[(4E)-4-(naphthalen-1-ylmethylidene)-5-oxo-1-phenylimidazol-2-yl]sulfanylethanimidate |
|---|---|
| PubChem CID | 53294498 |
| Molecular Formula | C26H22N6O3S |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | (1E)-N-[3-(dimethylamino)oxadiazol-3-ium-5-yl]-2-[(4E)-4-(naphthalen-1-ylmethylidene)-5-oxo-1-phenylimidazol-2-yl]sulfanylethanimidate |
| SMILES | CN(C)[n+]1cc(/N=C(/[O-])CSC2=N/C(=C/c3cccc4ccccc34)C(=O)N2c2ccccc2)on1 |
| InChI | InChI=1S/C26H22N6O3S/c1-30(2)31-16-24(35-29-31)28-23(33)17-36-26-27-22(25(34)32(26)20-12-4-3-5-13-20)15-19-11-8-10-18-9-6-7-14-21(18)19/h3-16H,17H2,1-2H3/b22-15+ |
| InChIKey | JHNJCXDPUKWIQA-PXLXIMEGSA-N |
| XLogP | 2.88 |
| TPSA | 101.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|