C23H20ClN5O4S — CID 53295770
(1E)-2-[(4E)-4-[(2-chlorophenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]ethanimidate (PubChem CID 53295770) has the molecular formula C23H20ClN5O4S and a molecular weight of 497.96 g/mol. Its IUPAC name is (1E)-2-[(4E)-4-[(2-chlorophenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]ethanimidate.
| Compound Name | (1E)-2-[(4E)-4-[(2-chlorophenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]ethanimidate |
|---|---|
| PubChem CID | 53295770 |
| Molecular Formula | C23H20ClN5O4S |
| Molecular Weight | 497.96 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | (1E)-2-[(4E)-4-[(2-chlorophenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]ethanimidate |
| SMILES | COCC[n+]1cc(/N=C(/[O-])CSC2=N/C(=C/c3ccccc3Cl)C(=O)N2c2ccccc2)on1 |
| InChI | InChI=1S/C23H20ClN5O4S/c1-32-12-11-28-14-21(33-27-28)26-20(30)15-34-23-25-19(13-16-7-5-6-10-18(16)24)22(31)29(23)17-8-3-2-4-9-17/h2-10,13-14H,11-12,15H2,1H3/b19-13+ |
| InChIKey | WWOGIKCKVMHPPW-CPNJWEJPSA-N |
| XLogP | 2.83 |
| TPSA | 107.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.96 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|