C25H26N5O6S+ — CID 53295695
2-[(4E)-4-[(2,3-dimethoxyphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]acetamide (PubChem CID 53295695) has the molecular formula C25H26N5O6S+ and a molecular weight of 524.58 g/mol. Its IUPAC name is 2-[(4E)-4-[(2,3-dimethoxyphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]acetamide.
| Compound Name | 2-[(4E)-4-[(2,3-dimethoxyphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]acetamide |
|---|---|
| PubChem CID | 53295695 |
| Molecular Formula | C25H26N5O6S+ |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | 2-[(4E)-4-[(2,3-dimethoxyphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]acetamide |
| SMILES | COCC[n+]1cc(NC(=O)CSC2=N/C(=C/c3cccc(OC)c3OC)C(=O)N2c2ccccc2)on1 |
| InChI | InChI=1S/C25H25N5O6S/c1-33-13-12-29-15-22(36-28-29)27-21(31)16-37-25-26-19(24(32)30(25)18-9-5-4-6-10-18)14-17-8-7-11-20(34-2)23(17)35-3/h4-11,14-15H,12-13,16H2,1-3H3/p+1/b19-14+ |
| InChIKey | UISKPVJDJPLXPW-XMHGGMMESA-O |
| XLogP | 2.74 |
| TPSA | 119.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|