C23H20N5O5S+ — CID 53294671
2-[(4E)-4-(1,3-benzodioxol-5-ylmethylidene)-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-(3-ethyloxadiazol-3-ium-5-yl)acetamide (PubChem CID 53294671) has the molecular formula C23H20N5O5S+ and a molecular weight of 478.51 g/mol. Its IUPAC name is 2-[(4E)-4-(1,3-benzodioxol-5-ylmethylidene)-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-(3-ethyloxadiazol-3-ium-5-yl)acetamide.
| Compound Name | 2-[(4E)-4-(1,3-benzodioxol-5-ylmethylidene)-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-(3-ethyloxadiazol-3-ium-5-yl)acetamide |
|---|---|
| PubChem CID | 53294671 |
| Molecular Formula | C23H20N5O5S+ |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 2-[(4E)-4-(1,3-benzodioxol-5-ylmethylidene)-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-(3-ethyloxadiazol-3-ium-5-yl)acetamide |
| SMILES | CC[n+]1cc(NC(=O)CSC2=N/C(=C/c3ccc4c(c3)OCO4)C(=O)N2c2ccccc2)on1 |
| InChI | InChI=1S/C23H19N5O5S/c1-2-27-12-21(33-26-27)25-20(29)13-34-23-24-17(22(30)28(23)16-6-4-3-5-7-16)10-15-8-9-18-19(11-15)32-14-31-18/h3-12H,2,13-14H2,1H3/p+1/b17-10+ |
| InChIKey | NYUPJSYPSYGYSZ-LICLKQGHSA-O |
| XLogP | 2.83 |
| TPSA | 110.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|