C22H18Cl2N5O3S+ — CID 53294661
2-[(4E)-4-[(2,4-dichlorophenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-(3-ethyloxadiazol-3-ium-5-yl)acetamide (PubChem CID 53294661) has the molecular formula C22H18Cl2N5O3S+ and a molecular weight of 503.39 g/mol. Its IUPAC name is 2-[(4E)-4-[(2,4-dichlorophenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-(3-ethyloxadiazol-3-ium-5-yl)acetamide.
| Compound Name | 2-[(4E)-4-[(2,4-dichlorophenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-(3-ethyloxadiazol-3-ium-5-yl)acetamide |
|---|---|
| PubChem CID | 53294661 |
| Molecular Formula | C22H18Cl2N5O3S+ |
| Molecular Weight | 503.39 g/mol |
| Exact Mass | 502.05 |
| IUPAC Name | 2-[(4E)-4-[(2,4-dichlorophenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-(3-ethyloxadiazol-3-ium-5-yl)acetamide |
| SMILES | CC[n+]1cc(NC(=O)CSC2=N/C(=C/c3ccc(Cl)cc3Cl)C(=O)N2c2ccccc2)on1 |
| InChI | InChI=1S/C22H17Cl2N5O3S/c1-2-28-12-20(32-27-28)26-19(30)13-33-22-25-18(10-14-8-9-15(23)11-17(14)24)21(31)29(22)16-6-4-3-5-7-16/h3-12H,2,13H2,1H3/p+1/b18-10+ |
| InChIKey | MRFPRKYLBNRWBB-VCHYOVAHSA-O |
| XLogP | 4.40 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|