C23H22N5O4S+ — CID 53293994
2-[(4E)-4-[(2-ethoxyphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-(3-methyloxadiazol-3-ium-5-yl)acetamide (PubChem CID 53293994) has the molecular formula C23H22N5O4S+ and a molecular weight of 464.53 g/mol. Its IUPAC name is 2-[(4E)-4-[(2-ethoxyphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-(3-methyloxadiazol-3-ium-5-yl)acetamide.
| Compound Name | 2-[(4E)-4-[(2-ethoxyphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-(3-methyloxadiazol-3-ium-5-yl)acetamide |
|---|---|
| PubChem CID | 53293994 |
| Molecular Formula | C23H22N5O4S+ |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 2-[(4E)-4-[(2-ethoxyphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-(3-methyloxadiazol-3-ium-5-yl)acetamide |
| SMILES | CCOc1ccccc1/C=C1/N=C(SCC(=O)Nc2c[n+](C)no2)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C23H21N5O4S/c1-3-31-19-12-8-7-9-16(19)13-18-22(30)28(17-10-5-4-6-11-17)23(24-18)33-15-20(29)25-21-14-27(2)26-32-21/h4-14H,3,15H2,1-2H3/p+1/b18-13+ |
| InChIKey | MHSKUGQWIUYENF-QGOAFFKASA-O |
| XLogP | 3.01 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|