C27H22F3N3O4S — CID 91969921
2-[4-[(2-ethoxyphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-[2-(trifluoromethoxy)phenyl]acetamide (PubChem CID 91969921) has the molecular formula C27H22F3N3O4S and a molecular weight of 541.55 g/mol. Its IUPAC name is 2-[4-[(2-ethoxyphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-[2-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[4-[(2-ethoxyphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-[2-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 91969921 |
| Molecular Formula | C27H22F3N3O4S |
| Molecular Weight | 541.55 g/mol |
| Exact Mass | 541.13 |
| IUPAC Name | 2-[4-[(2-ethoxyphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-[2-(trifluoromethoxy)phenyl]acetamide |
| SMILES | CCOc1ccccc1C=C1N=C(SCC(=O)Nc2ccccc2OC(F)(F)F)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C27H22F3N3O4S/c1-2-36-22-14-8-6-10-18(22)16-21-25(35)33(19-11-4-3-5-12-19)26(32-21)38-17-24(34)31-20-13-7-9-15-23(20)37-27(28,29)30/h3-16H,2,17H2,1H3,(H,31,34) |
| InChIKey | WJGIZMQMGSVPRA-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.55 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|