C23H16F3N3O3S2 — CID 91969796
2-[5-oxo-1-phenyl-4-(thiophen-2-ylmethylidene)imidazol-2-yl]sulfanyl-N-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 91969796) has the molecular formula C23H16F3N3O3S2 and a molecular weight of 503.53 g/mol. Its IUPAC name is 2-[5-oxo-1-phenyl-4-(thiophen-2-ylmethylidene)imidazol-2-yl]sulfanyl-N-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[5-oxo-1-phenyl-4-(thiophen-2-ylmethylidene)imidazol-2-yl]sulfanyl-N-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 91969796 |
| Molecular Formula | C23H16F3N3O3S2 |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 503.06 |
| IUPAC Name | 2-[5-oxo-1-phenyl-4-(thiophen-2-ylmethylidene)imidazol-2-yl]sulfanyl-N-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | O=C(CSC1=NC(=Cc2cccs2)C(=O)N1c1ccccc1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C23H16F3N3O3S2/c24-23(25,26)32-17-10-8-15(9-11-17)27-20(30)14-34-22-28-19(13-18-7-4-12-33-18)21(31)29(22)16-5-2-1-3-6-16/h1-13H,14H2,(H,27,30) |
| InChIKey | PVGYHLOJUJYQNN-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|