C22H15ClN2O2S2 — CID 125117914
(5Z)-2-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-3-phenyl-5-(thiophen-2-ylmethylidene)imidazol-4-one (PubChem CID 125117914) has the molecular formula C22H15ClN2O2S2 and a molecular weight of 438.96 g/mol. Its IUPAC name is (5Z)-2-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-3-phenyl-5-(thiophen-2-ylmethylidene)imidazol-4-one.
| Compound Name | (5Z)-2-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-3-phenyl-5-(thiophen-2-ylmethylidene)imidazol-4-one |
|---|---|
| PubChem CID | 125117914 |
| Molecular Formula | C22H15ClN2O2S2 |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.03 |
| IUPAC Name | (5Z)-2-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-3-phenyl-5-(thiophen-2-ylmethylidene)imidazol-4-one |
| SMILES | O=C(CSC1=N/C(=C\c2cccs2)C(=O)N1c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H15ClN2O2S2/c23-16-10-8-15(9-11-16)20(26)14-29-22-24-19(13-18-7-4-12-28-18)21(27)25(22)17-5-2-1-3-6-17/h1-13H,14H2/b19-13- |
| InChIKey | XTXFDDRRBQQZPZ-UYRXBGFRSA-N |
| XLogP | 5.76 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|