C24H17FN2O2S — CID 3409383
5-[(4-fluorophenyl)methylidene]-2-phenacylsulfanyl-3-phenylimidazol-4-one (PubChem CID 3409383) has the molecular formula C24H17FN2O2S and a molecular weight of 416.48 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)methylidene]-2-phenacylsulfanyl-3-phenylimidazol-4-one.
| Compound Name | 5-[(4-fluorophenyl)methylidene]-2-phenacylsulfanyl-3-phenylimidazol-4-one |
|---|---|
| PubChem CID | 3409383 |
| Molecular Formula | C24H17FN2O2S |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 5-[(4-fluorophenyl)methylidene]-2-phenacylsulfanyl-3-phenylimidazol-4-one |
| SMILES | O=C(CSC1=NC(=Cc2ccc(F)cc2)C(=O)N1c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H17FN2O2S/c25-19-13-11-17(12-14-19)15-21-23(29)27(20-9-5-2-6-10-20)24(26-21)30-16-22(28)18-7-3-1-4-8-18/h1-15H,16H2 |
| InChIKey | HXOVBFCYGUJXAD-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|