C24H19FN2O2S — CID 5138592
5-benzylidene-3-(4-fluorophenyl)-2-(2-phenoxyethylsulfanyl)imidazol-4-one (PubChem CID 5138592) has the molecular formula C24H19FN2O2S and a molecular weight of 418.49 g/mol. Its IUPAC name is 5-benzylidene-3-(4-fluorophenyl)-2-(2-phenoxyethylsulfanyl)imidazol-4-one.
| Compound Name | 5-benzylidene-3-(4-fluorophenyl)-2-(2-phenoxyethylsulfanyl)imidazol-4-one |
|---|---|
| PubChem CID | 5138592 |
| Molecular Formula | C24H19FN2O2S |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 5-benzylidene-3-(4-fluorophenyl)-2-(2-phenoxyethylsulfanyl)imidazol-4-one |
| SMILES | O=C1C(=Cc2ccccc2)N=C(SCCOc2ccccc2)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C24H19FN2O2S/c25-19-11-13-20(14-12-19)27-23(28)22(17-18-7-3-1-4-8-18)26-24(27)30-16-15-29-21-9-5-2-6-10-21/h1-14,17H,15-16H2 |
| InChIKey | CSKWQQJTHIPNCX-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|