C23H24FN3O2S — CID 5034992
2-[4-benzylidene-1-(4-fluorophenyl)-5-oxoimidazol-2-yl]sulfanyl-N-pentan-2-ylacetamide (PubChem CID 5034992) has the molecular formula C23H24FN3O2S and a molecular weight of 425.53 g/mol. Its IUPAC name is 2-[4-benzylidene-1-(4-fluorophenyl)-5-oxoimidazol-2-yl]sulfanyl-N-pentan-2-ylacetamide.
| Compound Name | 2-[4-benzylidene-1-(4-fluorophenyl)-5-oxoimidazol-2-yl]sulfanyl-N-pentan-2-ylacetamide |
|---|---|
| PubChem CID | 5034992 |
| Molecular Formula | C23H24FN3O2S |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 2-[4-benzylidene-1-(4-fluorophenyl)-5-oxoimidazol-2-yl]sulfanyl-N-pentan-2-ylacetamide |
| SMILES | CCCC(C)NC(=O)CSC1=NC(=Cc2ccccc2)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C23H24FN3O2S/c1-3-7-16(2)25-21(28)15-30-23-26-20(14-17-8-5-4-6-9-17)22(29)27(23)19-12-10-18(24)11-13-19/h4-6,8-14,16H,3,7,15H2,1-2H3,(H,25,28) |
| InChIKey | PNQDSHQIUWSRLX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|