C24H16F2N4O4S — CID 3546595
2-[4-benzylidene-1-(4-fluorophenyl)-5-oxoimidazol-2-yl]sulfanyl-N-(4-fluoro-2-nitrophenyl)acetamide (PubChem CID 3546595) has the molecular formula C24H16F2N4O4S and a molecular weight of 494.48 g/mol. Its IUPAC name is 2-[4-benzylidene-1-(4-fluorophenyl)-5-oxoimidazol-2-yl]sulfanyl-N-(4-fluoro-2-nitrophenyl)acetamide.
| Compound Name | 2-[4-benzylidene-1-(4-fluorophenyl)-5-oxoimidazol-2-yl]sulfanyl-N-(4-fluoro-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 3546595 |
| Molecular Formula | C24H16F2N4O4S |
| Molecular Weight | 494.48 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | 2-[4-benzylidene-1-(4-fluorophenyl)-5-oxoimidazol-2-yl]sulfanyl-N-(4-fluoro-2-nitrophenyl)acetamide |
| SMILES | O=C(CSC1=NC(=Cc2ccccc2)C(=O)N1c1ccc(F)cc1)Nc1ccc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H16F2N4O4S/c25-16-6-9-18(10-7-16)29-23(32)20(12-15-4-2-1-3-5-15)28-24(29)35-14-22(31)27-19-11-8-17(26)13-21(19)30(33)34/h1-13H,14H2,(H,27,31) |
| InChIKey | UEPSJSWACXUQOT-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|