C23H19FN4O4S2 — CID 2568032
2-[(4E)-4-benzylidene-1-(4-fluorophenyl)-5-oxoimidazol-2-yl]sulfanyl-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]acetamide (PubChem CID 2568032) has the molecular formula C23H19FN4O4S2 and a molecular weight of 498.56 g/mol. Its IUPAC name is 2-[(4E)-4-benzylidene-1-(4-fluorophenyl)-5-oxoimidazol-2-yl]sulfanyl-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]acetamide.
| Compound Name | 2-[(4E)-4-benzylidene-1-(4-fluorophenyl)-5-oxoimidazol-2-yl]sulfanyl-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 2568032 |
| Molecular Formula | C23H19FN4O4S2 |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | 2-[(4E)-4-benzylidene-1-(4-fluorophenyl)-5-oxoimidazol-2-yl]sulfanyl-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]acetamide |
| SMILES | O=C(CSC1=N/C(=C/c2ccccc2)C(=O)N1c1ccc(F)cc1)NCCN1C(=O)CSC1=O |
| InChI | InChI=1S/C23H19FN4O4S2/c24-16-6-8-17(9-7-16)28-21(31)18(12-15-4-2-1-3-5-15)26-22(28)33-13-19(29)25-10-11-27-20(30)14-34-23(27)32/h1-9,12H,10-11,13-14H2,(H,25,29)/b18-12+ |
| InChIKey | VBQFPPIJIXKOSB-LDADJPATSA-N |
| XLogP | 3.11 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|