C25H17F4N3O2S — CID 4645830
2-[4-benzylidene-1-(4-fluorophenyl)-5-oxoimidazol-2-yl]sulfanyl-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 4645830) has the molecular formula C25H17F4N3O2S and a molecular weight of 499.49 g/mol. Its IUPAC name is 2-[4-benzylidene-1-(4-fluorophenyl)-5-oxoimidazol-2-yl]sulfanyl-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-benzylidene-1-(4-fluorophenyl)-5-oxoimidazol-2-yl]sulfanyl-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 4645830 |
| Molecular Formula | C25H17F4N3O2S |
| Molecular Weight | 499.49 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | 2-[4-benzylidene-1-(4-fluorophenyl)-5-oxoimidazol-2-yl]sulfanyl-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CSC1=NC(=Cc2ccccc2)C(=O)N1c1ccc(F)cc1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C25H17F4N3O2S/c26-17-10-12-18(13-11-17)32-23(34)21(14-16-6-2-1-3-7-16)31-24(32)35-15-22(33)30-20-9-5-4-8-19(20)25(27,28)29/h1-14H,15H2,(H,30,33) |
| InChIKey | XNTKOQAOLHPPQE-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.49 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|