C25H26FN3O2S — CID 4007053
2-[4-benzylidene-1-(4-fluorophenyl)-5-oxoimidazol-2-yl]sulfanyl-N-(2-methylcyclohexyl)acetamide (PubChem CID 4007053) has the molecular formula C25H26FN3O2S and a molecular weight of 451.57 g/mol. Its IUPAC name is 2-[4-benzylidene-1-(4-fluorophenyl)-5-oxoimidazol-2-yl]sulfanyl-N-(2-methylcyclohexyl)acetamide.
| Compound Name | 2-[4-benzylidene-1-(4-fluorophenyl)-5-oxoimidazol-2-yl]sulfanyl-N-(2-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 4007053 |
| Molecular Formula | C25H26FN3O2S |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 2-[4-benzylidene-1-(4-fluorophenyl)-5-oxoimidazol-2-yl]sulfanyl-N-(2-methylcyclohexyl)acetamide |
| SMILES | CC1CCCCC1NC(=O)CSC1=NC(=Cc2ccccc2)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C25H26FN3O2S/c1-17-7-5-6-10-21(17)27-23(30)16-32-25-28-22(15-18-8-3-2-4-9-18)24(31)29(25)20-13-11-19(26)12-14-20/h2-4,8-9,11-15,17,21H,5-7,10,16H2,1H3,(H,27,30) |
| InChIKey | FYLVREOWKWEUFO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|