C22H14ClFN2O2S2 — CID 16544038
(5E)-5-benzylidene-2-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]sulfanyl-3-(4-fluorophenyl)imidazol-4-one (PubChem CID 16544038) has the molecular formula C22H14ClFN2O2S2 and a molecular weight of 456.95 g/mol. Its IUPAC name is (5E)-5-benzylidene-2-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]sulfanyl-3-(4-fluorophenyl)imidazol-4-one.
| Compound Name | (5E)-5-benzylidene-2-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]sulfanyl-3-(4-fluorophenyl)imidazol-4-one |
|---|---|
| PubChem CID | 16544038 |
| Molecular Formula | C22H14ClFN2O2S2 |
| Molecular Weight | 456.95 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | (5E)-5-benzylidene-2-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]sulfanyl-3-(4-fluorophenyl)imidazol-4-one |
| SMILES | O=C(CSC1=N/C(=C/c2ccccc2)C(=O)N1c1ccc(F)cc1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C22H14ClFN2O2S2/c23-20-11-10-19(30-20)18(27)13-29-22-25-17(12-14-4-2-1-3-5-14)21(28)26(22)16-8-6-15(24)7-9-16/h1-12H,13H2/b17-12+ |
| InChIKey | SSMYRMGKERGPMU-SFQUDFHCSA-N |
| XLogP | 5.90 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.95 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|