C27H22FN3O2S — CID 4816419
5-benzylidene-2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]sulfanyl-3-(4-fluorophenyl)imidazol-4-one (PubChem CID 4816419) has the molecular formula C27H22FN3O2S and a molecular weight of 471.56 g/mol. Its IUPAC name is 5-benzylidene-2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]sulfanyl-3-(4-fluorophenyl)imidazol-4-one.
| Compound Name | 5-benzylidene-2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]sulfanyl-3-(4-fluorophenyl)imidazol-4-one |
|---|---|
| PubChem CID | 4816419 |
| Molecular Formula | C27H22FN3O2S |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 5-benzylidene-2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]sulfanyl-3-(4-fluorophenyl)imidazol-4-one |
| SMILES | O=C(CSC1=NC(=Cc2ccccc2)C(=O)N1c1ccc(F)cc1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C27H22FN3O2S/c28-22-10-12-23(13-11-22)31-26(33)24(16-19-6-2-1-3-7-19)29-27(31)34-18-25(32)30-15-14-20-8-4-5-9-21(20)17-30/h1-13,16H,14-15,17-18H2 |
| InChIKey | VEZKHAWWLQOXQZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|