C25H27FN4O2S — CID 25484657
(5Z)-5-benzylidene-2-[(2S)-1-(4-ethylpiperazin-1-yl)-1-oxopropan-2-yl]sulfanyl-3-(4-fluorophenyl)imidazol-4-one (PubChem CID 25484657) has the molecular formula C25H27FN4O2S and a molecular weight of 466.58 g/mol. Its IUPAC name is (5Z)-5-benzylidene-2-[(2S)-1-(4-ethylpiperazin-1-yl)-1-oxopropan-2-yl]sulfanyl-3-(4-fluorophenyl)imidazol-4-one.
| Compound Name | (5Z)-5-benzylidene-2-[(2S)-1-(4-ethylpiperazin-1-yl)-1-oxopropan-2-yl]sulfanyl-3-(4-fluorophenyl)imidazol-4-one |
|---|---|
| PubChem CID | 25484657 |
| Molecular Formula | C25H27FN4O2S |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | (5Z)-5-benzylidene-2-[(2S)-1-(4-ethylpiperazin-1-yl)-1-oxopropan-2-yl]sulfanyl-3-(4-fluorophenyl)imidazol-4-one |
| SMILES | CCN1CCN(C(=O)[C@H](C)SC2=N/C(=C\c3ccccc3)C(=O)N2c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C25H27FN4O2S/c1-3-28-13-15-29(16-14-28)23(31)18(2)33-25-27-22(17-19-7-5-4-6-8-19)24(32)30(25)21-11-9-20(26)10-12-21/h4-12,17-18H,3,13-16H2,1-2H3/b22-17-/t18-/m0/s1 |
| InChIKey | NPOFNYNKWGNWHL-LSOGNMMWSA-N |
| XLogP | 3.86 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|