C24H21FN4O3S — CID 24527106
2-[(4Z)-4-benzylidene-1-(4-fluorophenyl)-5-oxoimidazol-2-yl]sulfanyl-N-(5-methyl-1,2-oxazol-3-yl)butanamide (PubChem CID 24527106) has the molecular formula C24H21FN4O3S and a molecular weight of 464.52 g/mol. Its IUPAC name is 2-[(4Z)-4-benzylidene-1-(4-fluorophenyl)-5-oxoimidazol-2-yl]sulfanyl-N-(5-methyl-1,2-oxazol-3-yl)butanamide.
| Compound Name | 2-[(4Z)-4-benzylidene-1-(4-fluorophenyl)-5-oxoimidazol-2-yl]sulfanyl-N-(5-methyl-1,2-oxazol-3-yl)butanamide |
|---|---|
| PubChem CID | 24527106 |
| Molecular Formula | C24H21FN4O3S |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 2-[(4Z)-4-benzylidene-1-(4-fluorophenyl)-5-oxoimidazol-2-yl]sulfanyl-N-(5-methyl-1,2-oxazol-3-yl)butanamide |
| SMILES | CCC(SC1=N/C(=C\c2ccccc2)C(=O)N1c1ccc(F)cc1)C(=O)Nc1cc(C)on1 |
| InChI | InChI=1S/C24H21FN4O3S/c1-3-20(22(30)27-21-13-15(2)32-28-21)33-24-26-19(14-16-7-5-4-6-8-16)23(31)29(24)18-11-9-17(25)10-12-18/h4-14,20H,3H2,1-2H3,(H,27,28,30)/b19-14- |
| InChIKey | WCLWZBTYEQUDSS-RGEXLXHISA-N |
| XLogP | 5.02 |
| TPSA | 87.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|