C22H19FN5O3S+ — CID 53294917
N-(3-ethyloxadiazol-3-ium-5-yl)-2-[(4E)-4-[(4-fluorophenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylacetamide (PubChem CID 53294917) has the molecular formula C22H19FN5O3S+ and a molecular weight of 452.49 g/mol. Its IUPAC name is N-(3-ethyloxadiazol-3-ium-5-yl)-2-[(4E)-4-[(4-fluorophenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylacetamide.
| Compound Name | N-(3-ethyloxadiazol-3-ium-5-yl)-2-[(4E)-4-[(4-fluorophenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 53294917 |
| Molecular Formula | C22H19FN5O3S+ |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | N-(3-ethyloxadiazol-3-ium-5-yl)-2-[(4E)-4-[(4-fluorophenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylacetamide |
| SMILES | CC[n+]1cc(NC(=O)CSC2=N/C(=C/c3ccc(F)cc3)C(=O)N2c2ccccc2)on1 |
| InChI | InChI=1S/C22H18FN5O3S/c1-2-27-13-20(31-26-27)25-19(29)14-32-22-24-18(12-15-8-10-16(23)11-9-15)21(30)28(22)17-6-4-3-5-7-17/h3-13H,2,14H2,1H3/p+1/b18-12+ |
| InChIKey | OKDXXCXUUNANLR-LDADJPATSA-O |
| XLogP | 3.24 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|