C12H14N3O2S+ — CID 53293964
N-(3-ethyloxadiazol-3-ium-5-yl)-2-phenylsulfanylacetamide (PubChem CID 53293964) has the molecular formula C12H14N3O2S+ and a molecular weight of 264.33 g/mol. Its IUPAC name is N-(3-ethyloxadiazol-3-ium-5-yl)-2-phenylsulfanylacetamide.
| Compound Name | N-(3-ethyloxadiazol-3-ium-5-yl)-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 53293964 |
| Molecular Formula | C12H14N3O2S+ |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | N-(3-ethyloxadiazol-3-ium-5-yl)-2-phenylsulfanylacetamide |
| SMILES | CC[n+]1cc(NC(=O)CSc2ccccc2)on1 |
| InChI | InChI=1S/C12H13N3O2S/c1-2-15-8-12(17-14-15)13-11(16)9-18-10-6-4-3-5-7-10/h3-8H,2,9H2,1H3/p+1 |
| InChIKey | IYOFATGNCUAFBY-UHFFFAOYSA-O |
| XLogP | 1.71 |
| TPSA | 59.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|