C17H20N5O4S+ — CID 53295885
2-(3-ethyl-4-oxoquinazolin-2-yl)sulfanyl-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]acetamide (PubChem CID 53295885) has the molecular formula C17H20N5O4S+ and a molecular weight of 390.45 g/mol. Its IUPAC name is 2-(3-ethyl-4-oxoquinazolin-2-yl)sulfanyl-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]acetamide.
| Compound Name | 2-(3-ethyl-4-oxoquinazolin-2-yl)sulfanyl-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]acetamide |
|---|---|
| PubChem CID | 53295885 |
| Molecular Formula | C17H20N5O4S+ |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 2-(3-ethyl-4-oxoquinazolin-2-yl)sulfanyl-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]acetamide |
| SMILES | CCn1c(SCC(=O)Nc2c[n+](CCOC)no2)nc2ccccc2c1=O |
| InChI | InChI=1S/C17H19N5O4S/c1-3-22-16(24)12-6-4-5-7-13(12)18-17(22)27-11-14(23)19-15-10-21(20-26-15)8-9-25-2/h4-7,10H,3,8-9,11H2,1-2H3/p+1 |
| InChIKey | OKZUJSRARCAGRD-UHFFFAOYSA-O |
| XLogP | 1.07 |
| TPSA | 103.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|