C12H15N4O3S+ — CID 53295755
N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]-2-pyridin-2-ylsulfanylacetamide (PubChem CID 53295755) has the molecular formula C12H15N4O3S+ and a molecular weight of 295.34 g/mol. Its IUPAC name is N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]-2-pyridin-2-ylsulfanylacetamide.
| Compound Name | N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]-2-pyridin-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 53295755 |
| Molecular Formula | C12H15N4O3S+ |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]-2-pyridin-2-ylsulfanylacetamide |
| SMILES | COCC[n+]1cc(NC(=O)CSc2ccccn2)on1 |
| InChI | InChI=1S/C12H14N4O3S/c1-18-7-6-16-8-11(19-15-16)14-10(17)9-20-12-4-2-3-5-13-12/h2-5,8H,6-7,9H2,1H3/p+1 |
| InChIKey | MVDUDFHOAQOXOZ-UHFFFAOYSA-O |
| XLogP | 0.73 |
| TPSA | 81.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|