C16H20N5O3S+ — CID 53295663
2-[(3-cyano-6-propan-2-yl-2-pyridinyl)sulfanyl]-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]acetamide (PubChem CID 53295663) has the molecular formula C16H20N5O3S+ and a molecular weight of 362.44 g/mol. Its IUPAC name is 2-[(3-cyano-6-propan-2-yl-2-pyridinyl)sulfanyl]-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]acetamide.
| Compound Name | 2-[(3-cyano-6-propan-2-yl-2-pyridinyl)sulfanyl]-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]acetamide |
|---|---|
| PubChem CID | 53295663 |
| Molecular Formula | C16H20N5O3S+ |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 2-[(3-cyano-6-propan-2-yl-2-pyridinyl)sulfanyl]-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]acetamide |
| SMILES | COCC[n+]1cc(NC(=O)CSc2nc(C(C)C)ccc2C#N)on1 |
| InChI | InChI=1S/C16H19N5O3S/c1-11(2)13-5-4-12(8-17)16(18-13)25-10-14(22)19-15-9-21(20-24-15)6-7-23-3/h4-5,9,11H,6-7,10H2,1-3H3/p+1 |
| InChIKey | OTAKETDVGSJPGT-UHFFFAOYSA-O |
| XLogP | 1.73 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|