C19H17ClN5O3S+ — CID 53295683
2-[[6-(4-chlorophenyl)-3-cyano-2-pyridinyl]sulfanyl]-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]acetamide (PubChem CID 53295683) has the molecular formula C19H17ClN5O3S+ and a molecular weight of 430.90 g/mol. Its IUPAC name is 2-[[6-(4-chlorophenyl)-3-cyano-2-pyridinyl]sulfanyl]-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]acetamide.
| Compound Name | 2-[[6-(4-chlorophenyl)-3-cyano-2-pyridinyl]sulfanyl]-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]acetamide |
|---|---|
| PubChem CID | 53295683 |
| Molecular Formula | C19H17ClN5O3S+ |
| Molecular Weight | 430.90 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 2-[[6-(4-chlorophenyl)-3-cyano-2-pyridinyl]sulfanyl]-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]acetamide |
| SMILES | COCC[n+]1cc(NC(=O)CSc2nc(-c3ccc(Cl)cc3)ccc2C#N)on1 |
| InChI | InChI=1S/C19H16ClN5O3S/c1-27-9-8-25-11-18(28-24-25)23-17(26)12-29-19-14(10-21)4-7-16(22-19)13-2-5-15(20)6-3-13/h2-7,11H,8-9,12H2,1H3/p+1 |
| InChIKey | JPSRPFGWALCVNS-UHFFFAOYSA-O |
| XLogP | 2.93 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.90 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|