C17H19N4O4S2+ — CID 53295687
N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]-2-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide (PubChem CID 53295687) has the molecular formula C17H19N4O4S2+ and a molecular weight of 407.50 g/mol. Its IUPAC name is N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]-2-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]-2-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 53295687 |
| Molecular Formula | C17H19N4O4S2+ |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]-2-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide |
| SMILES | COCC[n+]1cc(NC(=O)CSc2nc(-c3ccc(OC)cc3)cs2)on1 |
| InChI | InChI=1S/C17H18N4O4S2/c1-23-8-7-21-9-16(25-20-21)19-15(22)11-27-17-18-14(10-26-17)12-3-5-13(24-2)6-4-12/h3-6,9-10H,7-8,11H2,1-2H3/p+1 |
| InChIKey | OCGFOBGCMUNBQG-UHFFFAOYSA-O |
| XLogP | 2.47 |
| TPSA | 90.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|