C17H19N4O2S2+ — CID 53294401
2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(3-propan-2-yloxadiazol-3-ium-5-yl)acetamide (PubChem CID 53294401) has the molecular formula C17H19N4O2S2+ and a molecular weight of 375.50 g/mol. Its IUPAC name is 2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(3-propan-2-yloxadiazol-3-ium-5-yl)acetamide.
| Compound Name | 2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(3-propan-2-yloxadiazol-3-ium-5-yl)acetamide |
|---|---|
| PubChem CID | 53294401 |
| Molecular Formula | C17H19N4O2S2+ |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(3-propan-2-yloxadiazol-3-ium-5-yl)acetamide |
| SMILES | Cc1ccc(-c2csc(SCC(=O)Nc3c[n+](C(C)C)no3)n2)cc1 |
| InChI | InChI=1S/C17H18N4O2S2/c1-11(2)21-8-16(23-20-21)19-15(22)10-25-17-18-14(9-24-17)13-6-4-12(3)5-7-13/h4-9,11H,10H2,1-3H3/p+1 |
| InChIKey | OURFCVRVWHOWJQ-UHFFFAOYSA-O |
| XLogP | 3.71 |
| TPSA | 71.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|