C15H15ClN5O2S2+ — CID 53295367
2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-[3-(dimethylamino)oxadiazol-3-ium-5-yl]acetamide (PubChem CID 53295367) has the molecular formula C15H15ClN5O2S2+ and a molecular weight of 396.91 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-[3-(dimethylamino)oxadiazol-3-ium-5-yl]acetamide.
| Compound Name | 2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-[3-(dimethylamino)oxadiazol-3-ium-5-yl]acetamide |
|---|---|
| PubChem CID | 53295367 |
| Molecular Formula | C15H15ClN5O2S2+ |
| Molecular Weight | 396.91 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-[3-(dimethylamino)oxadiazol-3-ium-5-yl]acetamide |
| SMILES | CN(C)[n+]1cc(NC(=O)CSc2nc(-c3ccc(Cl)cc3)cs2)on1 |
| InChI | InChI=1S/C15H14ClN5O2S2/c1-20(2)21-7-14(23-19-21)18-13(22)9-25-15-17-12(8-24-15)10-3-5-11(16)6-4-10/h3-8H,9H2,1-2H3/p+1 |
| InChIKey | YHIMVQSUARDXOJ-UHFFFAOYSA-O |
| XLogP | 2.67 |
| TPSA | 75.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.91 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|