C10H15N6O2S+ — CID 53277299
2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-propan-2-yloxadiazol-3-ium-5-yl)acetamide (PubChem CID 53277299) has the molecular formula C10H15N6O2S+ and a molecular weight of 283.34 g/mol. Its IUPAC name is 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-propan-2-yloxadiazol-3-ium-5-yl)acetamide.
| Compound Name | 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-propan-2-yloxadiazol-3-ium-5-yl)acetamide |
|---|---|
| PubChem CID | 53277299 |
| Molecular Formula | C10H15N6O2S+ |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-propan-2-yloxadiazol-3-ium-5-yl)acetamide |
| SMILES | CC(C)[n+]1cc(NC(=O)CSc2nncn2C)on1 |
| InChI | InChI=1S/C10H14N6O2S/c1-7(2)16-4-9(18-14-16)12-8(17)5-19-10-13-11-6-15(10)3/h4,6-7H,5H2,1-3H3/p+1 |
| InChIKey | OFYNMIXVPLNHEB-UHFFFAOYSA-O |
| XLogP | 0.40 |
| TPSA | 89.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|