C11H16N7O3S+ — CID 53295635
2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]acetamide (PubChem CID 53295635) has the molecular formula C11H16N7O3S+ and a molecular weight of 326.36 g/mol. Its IUPAC name is 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]acetamide.
| Compound Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]acetamide |
|---|---|
| PubChem CID | 53295635 |
| Molecular Formula | C11H16N7O3S+ |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]acetamide |
| SMILES | COCC[n+]1cc(NC(=O)CSc2nc(N)cc(N)n2)on1 |
| InChI | InChI=1S/C11H15N7O3S/c1-20-3-2-18-5-10(21-17-18)16-9(19)6-22-11-14-7(12)4-8(13)15-11/h4-5H,2-3,6H2,1H3,(H4-,12,13,14,15,16,17,19)/p+1 |
| InChIKey | NQGCTWNYQHQJLR-UHFFFAOYSA-O |
| XLogP | -0.71 |
| TPSA | 146.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|