C8H10N7O2S+ — CID 53294243
2-[(4-amino-1,3,5-triazin-2-yl)sulfanyl]-N-(3-methyloxadiazol-3-ium-5-yl)acetamide (PubChem CID 53294243) has the molecular formula C8H10N7O2S+ and a molecular weight of 268.28 g/mol. Its IUPAC name is 2-[(4-amino-1,3,5-triazin-2-yl)sulfanyl]-N-(3-methyloxadiazol-3-ium-5-yl)acetamide.
| Compound Name | 2-[(4-amino-1,3,5-triazin-2-yl)sulfanyl]-N-(3-methyloxadiazol-3-ium-5-yl)acetamide |
|---|---|
| PubChem CID | 53294243 |
| Molecular Formula | C8H10N7O2S+ |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 2-[(4-amino-1,3,5-triazin-2-yl)sulfanyl]-N-(3-methyloxadiazol-3-ium-5-yl)acetamide |
| SMILES | C[n+]1cc(NC(=O)CSc2ncnc(N)n2)on1 |
| InChI | InChI=1S/C8H9N7O2S/c1-15-2-6(17-14-15)12-5(16)3-18-8-11-4-10-7(9)13-8/h2,4H,3H2,1H3,(H2-,9,10,11,12,13,14,16)/p+1 |
| InChIKey | QUZDLFLNRHJIJG-UHFFFAOYSA-O |
| XLogP | -1.00 |
| TPSA | 123.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|