C8H10N5O2S2+ — CID 53294285
N-(3-methyloxadiazol-3-ium-5-yl)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide (PubChem CID 53294285) has the molecular formula C8H10N5O2S2+ and a molecular weight of 272.34 g/mol. Its IUPAC name is N-(3-methyloxadiazol-3-ium-5-yl)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-(3-methyloxadiazol-3-ium-5-yl)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 53294285 |
| Molecular Formula | C8H10N5O2S2+ |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | N-(3-methyloxadiazol-3-ium-5-yl)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
| SMILES | Cc1nnc(SCC(=O)Nc2c[n+](C)no2)s1 |
| InChI | InChI=1S/C8H9N5O2S2/c1-5-10-11-8(17-5)16-4-6(14)9-7-3-13(2)12-15-7/h3H,4H2,1-2H3/p+1 |
| InChIKey | IPQQJZJCAJQPSH-UHFFFAOYSA-O |
| XLogP | 0.39 |
| TPSA | 84.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|