C24H20N5O2S+ — CID 53294130
2-[[3-cyano-4-(4-methylphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-(3-methyloxadiazol-3-ium-5-yl)acetamide (PubChem CID 53294130) has the molecular formula C24H20N5O2S+ and a molecular weight of 442.52 g/mol. Its IUPAC name is 2-[[3-cyano-4-(4-methylphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-(3-methyloxadiazol-3-ium-5-yl)acetamide.
| Compound Name | 2-[[3-cyano-4-(4-methylphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-(3-methyloxadiazol-3-ium-5-yl)acetamide |
|---|---|
| PubChem CID | 53294130 |
| Molecular Formula | C24H20N5O2S+ |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 2-[[3-cyano-4-(4-methylphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-(3-methyloxadiazol-3-ium-5-yl)acetamide |
| SMILES | Cc1ccc(-c2cc(-c3ccccc3)nc(SCC(=O)Nc3c[n+](C)no3)c2C#N)cc1 |
| InChI | InChI=1S/C24H19N5O2S/c1-16-8-10-17(11-9-16)19-12-21(18-6-4-3-5-7-18)26-24(20(19)13-25)32-15-22(30)27-23-14-29(2)28-31-23/h3-12,14H,15H2,1-2H3/p+1 |
| InChIKey | IIMHNXSUSTXXRE-UHFFFAOYSA-O |
| XLogP | 4.14 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|