C25H22N5O4S+ — CID 53294148
2-[[3-cyano-4-(2,3-dimethoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-(3-methyloxadiazol-3-ium-5-yl)acetamide (PubChem CID 53294148) has the molecular formula C25H22N5O4S+ and a molecular weight of 488.55 g/mol. Its IUPAC name is 2-[[3-cyano-4-(2,3-dimethoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-(3-methyloxadiazol-3-ium-5-yl)acetamide.
| Compound Name | 2-[[3-cyano-4-(2,3-dimethoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-(3-methyloxadiazol-3-ium-5-yl)acetamide |
|---|---|
| PubChem CID | 53294148 |
| Molecular Formula | C25H22N5O4S+ |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 2-[[3-cyano-4-(2,3-dimethoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-(3-methyloxadiazol-3-ium-5-yl)acetamide |
| SMILES | COc1cccc(-c2cc(-c3ccccc3)nc(SCC(=O)Nc3c[n+](C)no3)c2C#N)c1OC |
| InChI | InChI=1S/C25H21N5O4S/c1-30-14-23(34-29-30)28-22(31)15-35-25-19(13-26)18(12-20(27-25)16-8-5-4-6-9-16)17-10-7-11-21(32-2)24(17)33-3/h4-12,14H,15H2,1-3H3/p+1 |
| InChIKey | ZFIYLQJMPQHEFA-UHFFFAOYSA-O |
| XLogP | 3.85 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|