C23H17N5O2S — CID 53294111
(1E)-2-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-methyloxadiazol-3-ium-5-yl)ethanimidate (PubChem CID 53294111) has the molecular formula C23H17N5O2S and a molecular weight of 427.49 g/mol. Its IUPAC name is (1E)-2-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-methyloxadiazol-3-ium-5-yl)ethanimidate.
| Compound Name | (1E)-2-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-methyloxadiazol-3-ium-5-yl)ethanimidate |
|---|---|
| PubChem CID | 53294111 |
| Molecular Formula | C23H17N5O2S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | (1E)-2-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-methyloxadiazol-3-ium-5-yl)ethanimidate |
| SMILES | C[n+]1cc(/N=C(/[O-])CSc2nc(-c3ccccc3)cc(-c3ccccc3)c2C#N)on1 |
| InChI | InChI=1S/C23H17N5O2S/c1-28-14-22(30-27-28)26-21(29)15-31-23-19(13-24)18(16-8-4-2-5-9-16)12-20(25-23)17-10-6-3-7-11-17/h2-12,14H,15H2,1H3 |
| InChIKey | KDDXTETYNFGKKU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 102.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|