C26H24N6O3S — CID 53294488
(1E)-2-[[3-cyano-6-(4-methoxyphenyl)-4-(4-methylphenyl)-2-pyridinyl]sulfanyl]-N-[3-(dimethylamino)oxadiazol-3-ium-5-yl]ethanimidate (PubChem CID 53294488) has the molecular formula C26H24N6O3S and a molecular weight of 500.58 g/mol. Its IUPAC name is (1E)-2-[[3-cyano-6-(4-methoxyphenyl)-4-(4-methylphenyl)-2-pyridinyl]sulfanyl]-N-[3-(dimethylamino)oxadiazol-3-ium-5-yl]ethanimidate.
| Compound Name | (1E)-2-[[3-cyano-6-(4-methoxyphenyl)-4-(4-methylphenyl)-2-pyridinyl]sulfanyl]-N-[3-(dimethylamino)oxadiazol-3-ium-5-yl]ethanimidate |
|---|---|
| PubChem CID | 53294488 |
| Molecular Formula | C26H24N6O3S |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | (1E)-2-[[3-cyano-6-(4-methoxyphenyl)-4-(4-methylphenyl)-2-pyridinyl]sulfanyl]-N-[3-(dimethylamino)oxadiazol-3-ium-5-yl]ethanimidate |
| SMILES | COc1ccc(-c2cc(-c3ccc(C)cc3)c(C#N)c(SC/C([O-])=N\c3c[n+](N(C)C)no3)n2)cc1 |
| InChI | InChI=1S/C26H24N6O3S/c1-17-5-7-18(8-6-17)21-13-23(19-9-11-20(34-4)12-10-19)28-26(22(21)14-27)36-16-24(33)29-25-15-32(30-35-25)31(2)3/h5-13,15H,16H2,1-4H3 |
| InChIKey | VSHPJTXKMAYQID-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 114.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|