C20H17N7O3S — CID 53295892
(1E)-2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanyl]-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]ethanimidate (PubChem CID 53295892) has the molecular formula C20H17N7O3S and a molecular weight of 435.47 g/mol. Its IUPAC name is (1E)-2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanyl]-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]ethanimidate.
| Compound Name | (1E)-2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanyl]-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]ethanimidate |
|---|---|
| PubChem CID | 53295892 |
| Molecular Formula | C20H17N7O3S |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | (1E)-2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanyl]-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]ethanimidate |
| SMILES | COCC[n+]1cc(/N=C(/[O-])CSc2nc(N)c(C#N)c(-c3ccccc3)c2C#N)on1 |
| InChI | InChI=1S/C20H17N7O3S/c1-29-8-7-27-11-17(30-26-27)24-16(28)12-31-20-15(10-22)18(13-5-3-2-4-6-13)14(9-21)19(23)25-20/h2-6,11H,7-8,12H2,1H3,(H2-,23,24,25,26,28) |
| InChIKey | GADKGLHUMNCOOU-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 161.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|