C23H22N8O3S — CID 53294970
(1E)-2-[[6-amino-3,5-dicyano-4-(4-ethylphenyl)-2-pyridinyl]sulfanyl]-N-(3-morpholin-4-yloxadiazol-3-ium-5-yl)ethanimidate (PubChem CID 53294970) has the molecular formula C23H22N8O3S and a molecular weight of 490.55 g/mol. Its IUPAC name is (1E)-2-[[6-amino-3,5-dicyano-4-(4-ethylphenyl)-2-pyridinyl]sulfanyl]-N-(3-morpholin-4-yloxadiazol-3-ium-5-yl)ethanimidate.
| Compound Name | (1E)-2-[[6-amino-3,5-dicyano-4-(4-ethylphenyl)-2-pyridinyl]sulfanyl]-N-(3-morpholin-4-yloxadiazol-3-ium-5-yl)ethanimidate |
|---|---|
| PubChem CID | 53294970 |
| Molecular Formula | C23H22N8O3S |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | (1E)-2-[[6-amino-3,5-dicyano-4-(4-ethylphenyl)-2-pyridinyl]sulfanyl]-N-(3-morpholin-4-yloxadiazol-3-ium-5-yl)ethanimidate |
| SMILES | CCc1ccc(-c2c(C#N)c(N)nc(SC/C([O-])=N\c3c[n+](N4CCOCC4)no3)c2C#N)cc1 |
| InChI | InChI=1S/C23H22N8O3S/c1-2-15-3-5-16(6-4-15)21-17(11-24)22(26)28-23(18(21)12-25)35-14-19(32)27-20-13-31(29-34-20)30-7-9-33-10-8-30/h3-6,13H,2,7-10,14H2,1H3,(H2-,26,27,28,29,32) |
| InChIKey | UGZYRCWALVCBNW-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 164.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|