C24H16N6O4S — CID 53290157
4-[2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanyl]acetyl]-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate (PubChem CID 53290157) has the molecular formula C24H16N6O4S and a molecular weight of 484.50 g/mol. Its IUPAC name is 4-[2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanyl]acetyl]-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate.
| Compound Name | 4-[2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanyl]acetyl]-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53290157 |
| Molecular Formula | C24H16N6O4S |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | 4-[2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanyl]acetyl]-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate |
| SMILES | COc1ccc(-[n+]2noc([O-])c2C(=O)CSc2nc(N)c(C#N)c(-c3ccccc3)c2C#N)cc1 |
| InChI | InChI=1S/C24H16N6O4S/c1-33-16-9-7-15(8-10-16)30-21(24(32)34-29-30)19(31)13-35-23-18(12-26)20(14-5-3-2-4-6-14)17(11-25)22(27)28-23/h2-10H,13H2,1H3,(H2-,27,28,29,31,32) |
| InChIKey | YHJHBTROOJDGDO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 165.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|